Products 681283-18-1
CAS 681283-18-1 is the registry number for Methyl (S)-1-(tert-butyloxycarbonyl)-4-(difluoromethylene)pyrrolidine-2-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg.
1-O-tert-butyl 2-O-methyl (2S)-4-(difluoromethylidene)pyrrolidine-1,2-dicarboxylate (CAS 681283-18-1) is a chemical compound with the molecular formula C12H17F2NO4 and a molecular weight of 277.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-4-(difluoromethylidene)pyrrolidine-1,2-dicarboxylate. InChIKey: IHXJNTPXPHGTTI-QMMMGPOBSA-N.
| Molecular formula | C12H17F2NO4 |
|---|---|
| Molecular weight | 277.26 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-4-(difluoromethylidene)pyrrolidine-1,2-dicarboxylate |
| InChIKey | IHXJNTPXPHGTTI-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=C(F)F)C[C@H]1C(=O)OC |
Computed by PubChem (NCBI)