Products 68178-69-8
CAS 68178-69-8 appears in our catalog under these names: 2-(3-Trifluoromethyl-phenyl)-4h-isoquinoline-1,3-dione, 95%, 2-(3-(Trifluoromethyl)phenyl)-1,2,3,4-tetrahydroisoquinoline-1,3-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[3-(trifluoromethyl)phenyl]-4H-isoquinoline-1,3-dione (CAS 68178-69-8) is a chemical compound with the molecular formula C16H10F3NO2 and a molecular weight of 305.25 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]-4H-isoquinoline-1,3-dione. InChIKey: WRSIWKWKAZBXHE-UHFFFAOYSA-N.
| Molecular formula | C16H10F3NO2 |
|---|---|
| Molecular weight | 305.25 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]-4H-isoquinoline-1,3-dione |
| InChIKey | WRSIWKWKAZBXHE-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(=O)N(C1=O)C3=CC=CC(=C3)C(F)(F)F |
Computed by PubChem (NCBI)