CAS 923281-61-2 is the registry number for 3'-Formyl-4'-methoxy-2-(trifluoromethyl)biphenyl-4-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(3-formyl-4-methoxyphenyl)-3-(trifluoromethyl)benzonitrile (CAS 923281-61-2) is a chemical compound with the molecular formula C16H10F3NO2 and a molecular weight of 305.25 g/mol. IUPAC name: 4-(3-formyl-4-methoxyphenyl)-3-(trifluoromethyl)benzonitrile. InChIKey: WIYMIZXNNDYDCE-UHFFFAOYSA-N.
| Molecular formula | C16H10F3NO2 |
|---|---|
| Molecular weight | 305.25 g/mol |
| IUPAC name | 4-(3-formyl-4-methoxyphenyl)-3-(trifluoromethyl)benzonitrile |
| InChIKey | WIYMIZXNNDYDCE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(C=C(C=C2)C#N)C(F)(F)F)C=O |
Computed by PubChem (NCBI)