Products 923281-71-4
CAS 923281-71-4 is the registry number for 3'-Formyl-4'-(2,2,2-trifluoroethoxy)biphenyl-4-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-[3-formyl-4-(2,2,2-trifluoroethoxy)phenyl]benzonitrile (CAS 923281-71-4) is a chemical compound with the molecular formula C16H10F3NO2 and a molecular weight of 305.25 g/mol. IUPAC name: 4-[3-formyl-4-(2,2,2-trifluoroethoxy)phenyl]benzonitrile. InChIKey: BJHDCDSCEDRVOO-UHFFFAOYSA-N.
| Molecular formula | C16H10F3NO2 |
|---|---|
| Molecular weight | 305.25 g/mol |
| IUPAC name | 4-[3-formyl-4-(2,2,2-trifluoroethoxy)phenyl]benzonitrile |
| InChIKey | BJHDCDSCEDRVOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CC(=C(C=C2)OCC(F)(F)F)C=O |
Computed by PubChem (NCBI)