CAS 681837-49-0 is the registry number for [3-(6-Methyl-5,6-dihydro[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)phenyl]amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(6-methyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)aniline (CAS 681837-49-0) is a chemical compound with the molecular formula C11H12N4S and a molecular weight of 232.31 g/mol. IUPAC name: 3-(6-methyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)aniline. InChIKey: VLBWKJSSFSOVEN-UHFFFAOYSA-N.
| Molecular formula | C11H12N4S |
|---|---|
| Molecular weight | 232.31 g/mol |
| IUPAC name | 3-(6-methyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)aniline |
| InChIKey | VLBWKJSSFSOVEN-UHFFFAOYSA-N |
| SMILES | CC1CN2C(=NN=C2S1)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)