CAS 7120-04-9 is the registry number for N-[4-(4-Methylphenyl)-1,3-thiazol-2-yl]guanidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]guanidine (CAS 7120-04-9) is a chemical compound with the molecular formula C11H12N4S and a molecular weight of 232.31 g/mol. IUPAC name: 2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]guanidine. InChIKey: ZDGAXVHTLHPERL-UHFFFAOYSA-N.
| Molecular formula | C11H12N4S |
|---|---|
| Molecular weight | 232.31 g/mol |
| IUPAC name | 2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]guanidine |
| InChIKey | ZDGAXVHTLHPERL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC(=N2)N=C(N)N |
Computed by PubChem (NCBI)