CAS 84890-62-0 appears in our catalog under these names: 2-(Benzylthio)pyrimidine-4,6-diamine, 95%, 2–(Benzylthio)–4,6–pyrimidinediamine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
2-benzylsulfanylpyrimidine-4,6-diamine (CAS 84890-62-0) is a chemical compound with the molecular formula C11H12N4S and a molecular weight of 232.31 g/mol. IUPAC name: 2-benzylsulfanylpyrimidine-4,6-diamine. InChIKey: DAZJCNWHHPUGCC-UHFFFAOYSA-N.
| Molecular formula | C11H12N4S |
|---|---|
| Molecular weight | 232.31 g/mol |
| IUPAC name | 2-benzylsulfanylpyrimidine-4,6-diamine |
| InChIKey | DAZJCNWHHPUGCC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NC(=CC(=N2)N)N |
Computed by PubChem (NCBI)