Products 68194-16-1

CAS 68194-16-1 is the registry number for PCB 173, ROTI®Star, 5 mg, glass. Offered by: Roth. Available pack sizes: 5mg.

Structural formula: {0} (CAS {1})

1,2,3,4,5-pentachloro-6-(2,3-dichlorophenyl)benzene (CAS 68194-16-1) is a chemical compound with the molecular formula C12H3Cl7 and a molecular weight of 395.3 g/mol. IUPAC name: 1,2,3,4,5-pentachloro-6-(2,3-dichlorophenyl)benzene. InChIKey: PAYFWJAKKLILIT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H3Cl7
Molecular weight395.3 g/mol
IUPAC name1,2,3,4,5-pentachloro-6-(2,3-dichlorophenyl)benzene
InChIKeyPAYFWJAKKLILIT-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)Cl)C2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)Cl

Computed by PubChem (NCBI)