CAS 68208-20-8 appears in our catalog under these names: 3-Amino-3-(2-chlorophenyl)propanoic acid, 95%, 3–Amino–3–(2–chlorophenyl)propanoic acid, 3-Amino-3-(2-chlorophenyl)propanoic acid, 98%, 98%, 3-Amino-3-(2-chlorophenyl)propanoic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg, 10g.
3-amino-3-(2-chlorophenyl)propanoic acid (CAS 68208-20-8) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 3-amino-3-(2-chlorophenyl)propanoic acid. InChIKey: NXXFYRJVRISCCP-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 3-amino-3-(2-chlorophenyl)propanoic acid |
| InChIKey | NXXFYRJVRISCCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(CC(=O)O)N)Cl |
Computed by PubChem (NCBI)