Products 682339-44-2
CAS 682339-44-2 is the registry number for 5-Nitro-2-((oxiran-2-yl)methoxy)phenol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-nitro-2-(oxiran-2-ylmethoxy)phenol (CAS 682339-44-2) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: 5-nitro-2-(oxiran-2-ylmethoxy)phenol. InChIKey: CTRHKWRKWVRFBW-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 5-nitro-2-(oxiran-2-ylmethoxy)phenol |
| InChIKey | CTRHKWRKWVRFBW-UHFFFAOYSA-N |
| SMILES | C1C(O1)COC2=C(C=C(C=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)