CAS 68254-48-8 appears in our catalog under these names: 10-Oxo Morphine, >95% (HPLC), 10-Oxo Morphine (1mg/ml in Acetonitrile), 10-Oxo Morphine (100μg/ml in Methanol), 10-Oxomorphine. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 1x1ml, 5mg, 25mg, 50mg.
(4S,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-1,2,4,4a,7,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-13-one (CAS 68254-48-8) is a chemical compound with the molecular formula C17H17NO4 and a molecular weight of 299.32 g/mol. IUPAC name: (4S,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-1,2,4,4a,7,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-13-one. InChIKey: HNJBQZPKNKFLFM-CBEJNMEVSA-N.
| Molecular formula | C17H17NO4 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | (4S,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-1,2,4,4a,7,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-13-one |
| InChIKey | HNJBQZPKNKFLFM-CBEJNMEVSA-N |
| SMILES | CN1CC[C@]23[C@@H]4[C@H]1C(=O)C5=C2C(=C(C=C5)O)O[C@H]3[C@H](C=C4)O |
Computed by PubChem (NCBI)