Products 68287-29-6
CAS 68287-29-6 appears in our catalog under these names: 3-[(1,1-Dioxido-1,2-benzisothiazol-3-yl)amino]propan-1-ol, 95%, 3-((3-Hydroxypropyl)amino)benzo(d)isothiazole 1,1-dioxide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propan-1-ol (CAS 68287-29-6) is a chemical compound with the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. IUPAC name: 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propan-1-ol. InChIKey: OXCQCCRYWDLSLV-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3S |
|---|---|
| Molecular weight | 240.28 g/mol |
| IUPAC name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propan-1-ol |
| InChIKey | OXCQCCRYWDLSLV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NCCCO)NS2(=O)=O |
Computed by PubChem (NCBI)