CAS 1269384-68-0 is the registry number for [(5-Methyl-1h-benzimidazol-2-yl)thio]acetic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetic acid;hydrate (CAS 1269384-68-0) is a chemical compound with the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. IUPAC name: 2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetic acid;hydrate. InChIKey: UOQVQFRULLKOAM-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3S |
|---|---|
| Molecular weight | 240.28 g/mol |
| IUPAC name | 2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetic acid;hydrate |
| InChIKey | UOQVQFRULLKOAM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N2)SCC(=O)O.O |
Computed by PubChem (NCBI)