CAS 3304-81-2 is the registry number for 5-(2-Oxo-2,3-dihydro-1h-thieno[3,4-d]imidazol-4-yl)pentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoic acid (CAS 3304-81-2) is a chemical compound with the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. IUPAC name: 5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoic acid. InChIKey: AEKJLVWBPNZVGQ-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3S |
|---|---|
| Molecular weight | 240.28 g/mol |
| IUPAC name | 5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoic acid |
| InChIKey | AEKJLVWBPNZVGQ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(S1)CCCCC(=O)O)NC(=O)N2 |
Computed by PubChem (NCBI)