CAS 1344039-20-8 appears in our catalog under these names: 2,2-Dimethyl-3-[(1,3-thiazol-2-ylamino)carbonyl]cyclopropanecarboxylic acid, 95%, 2,2-DImethyl-3-((1,3-thiazol-2-ylamino)carbonyl)cyclopropanecarboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2,2-dimethyl-3-(1,3-thiazol-2-ylcarbamoyl)cyclopropane-1-carboxylic acid (CAS 1344039-20-8) is a chemical compound with the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. IUPAC name: 2,2-dimethyl-3-(1,3-thiazol-2-ylcarbamoyl)cyclopropane-1-carboxylic acid. InChIKey: LYWNCSZRGOAWHN-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3S |
|---|---|
| Molecular weight | 240.28 g/mol |
| IUPAC name | 2,2-dimethyl-3-(1,3-thiazol-2-ylcarbamoyl)cyclopropane-1-carboxylic acid |
| InChIKey | LYWNCSZRGOAWHN-UHFFFAOYSA-N |
| SMILES | CC1(C(C1C(=O)O)C(=O)NC2=NC=CS2)C |
Computed by PubChem (NCBI)