Products 683219-86-5

CAS 683219-86-5 is the registry number for 3-(Boc-NH)-octanoic acid. Offered by: Iris Biotech. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-[(2-methylpropan-2-yl)oxycarbonylamino]octanoic acid (CAS 683219-86-5) is a chemical compound with the molecular formula C13H25NO4 and a molecular weight of 259.34 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]octanoic acid. InChIKey: LCMKZSKQXGASTD-UHFFFAOYSA-N.

Identity
Molecular formulaC13H25NO4
Molecular weight259.34 g/mol
IUPAC name3-[(2-methylpropan-2-yl)oxycarbonylamino]octanoic acid
InChIKeyLCMKZSKQXGASTD-UHFFFAOYSA-N
SMILESCCCCCC(CC(=O)O)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)