CAS 683274-50-2 appears in our catalog under these names: N-Isopropyl 4-bromo-2-nitroaniline, 95%, N-Isopropyl 4-bromo-2-nitroaniline, 98%, 98%, N-iso-Propyl 4-bromo-2-nitroaniline, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg.
4-bromo-2-nitro-N-propan-2-ylaniline (CAS 683274-50-2) is a chemical compound with the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. IUPAC name: 4-bromo-2-nitro-N-propan-2-ylaniline. InChIKey: QKZASAQBZATLAE-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O2 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 4-bromo-2-nitro-N-propan-2-ylaniline |
| InChIKey | QKZASAQBZATLAE-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=C(C=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)