Products 68347-90-0

CAS 68347-90-0 is the registry number for 2-{6-Methylimidazo(2,1-b)(1,3)thiazol-3-yl}acetic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid (CAS 68347-90-0) is a chemical compound with the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. IUPAC name: 2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid. InChIKey: CTNHTIHQPGDYJK-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8N2O2S
Molecular weight196.23 g/mol
IUPAC name2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid
InChIKeyCTNHTIHQPGDYJK-UHFFFAOYSA-N
SMILESCC1=CN2C(=CSC2=N1)CC(=O)O

Computed by PubChem (NCBI)