CAS 68347-90-0 is the registry number for 2-{6-Methylimidazo(2,1-b)(1,3)thiazol-3-yl}acetic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid (CAS 68347-90-0) is a chemical compound with the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. IUPAC name: 2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid. InChIKey: CTNHTIHQPGDYJK-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid |
| InChIKey | CTNHTIHQPGDYJK-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=CSC2=N1)CC(=O)O |
Computed by PubChem (NCBI)