CAS 68406-47-3 appears in our catalog under these names: 5-Chloro-N1-phenylbenzene-1,2-diamine, 5-Chloro-1-N-phenylbenzene-1,2-diamine, 5-Chloro-N1-phenylbenzene-1,2-diamine 95+%, 5-Chloro-N1-phenylbenzene-1,2-diamine, 95+%, 95+%. Offered by: TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 500mg, 50mg, 1g, 5g, 10g, 25g.
4-chloro-2-N-phenylbenzene-1,2-diamine (CAS 68406-47-3) is a chemical compound with the molecular formula C12H11ClN2 and a molecular weight of 218.68 g/mol. IUPAC name: 4-chloro-2-N-phenylbenzene-1,2-diamine. InChIKey: YRPYUECFYIYBGG-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2 |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | 4-chloro-2-N-phenylbenzene-1,2-diamine |
| InChIKey | YRPYUECFYIYBGG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=C(C=CC(=C2)Cl)N |
Computed by PubChem (NCBI)