CAS 68468-14-4 is the registry number for 7-(Benzyloxy)-5,6-dihydroxycoumarin. Offered by: TRC. Available pack sizes: 100mg.
5,6-dihydroxy-7-phenylmethoxychromen-2-one (CAS 68468-14-4) is a chemical compound with the molecular formula C16H12O5 and a molecular weight of 284.26 g/mol. IUPAC name: 5,6-dihydroxy-7-phenylmethoxychromen-2-one. InChIKey: JGOUVDVWCXVORI-UHFFFAOYSA-N.
| Molecular formula | C16H12O5 |
|---|---|
| Molecular weight | 284.26 g/mol |
| IUPAC name | 5,6-dihydroxy-7-phenylmethoxychromen-2-one |
| InChIKey | JGOUVDVWCXVORI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C3C=CC(=O)OC3=C2)O)O |
Computed by PubChem (NCBI)