CAS 68471-57-8 appears in our catalog under these names: Benzyl 2,3-dihydropyrrole-1-carboxylate, 95%, Benzyl 2,3–dihydro–1H–pyrrole–1–carboxylate, N-Benzyloxycarbonyl-2,3-dihydropyrrole, Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate 98%, BENZYL 2,3-DIHYDRO-1H-PYRROLE-1-CARBOXYLATE, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 2g, 10g, 25g.
Benzyl 2,3-dihydropyrrole-1-carboxylate (CAS 68471-57-8) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: benzyl 2,3-dihydropyrrole-1-carboxylate. InChIKey: ZNLOEFQSAKKFGT-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | benzyl 2,3-dihydropyrrole-1-carboxylate |
| InChIKey | ZNLOEFQSAKKFGT-UHFFFAOYSA-N |
| SMILES | C1CN(C=C1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)