Products 68535-57-9

CAS 68535-57-9 is the registry number for 4-(1,3-Thiazol-4-yl)phenol. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 50mg, 100mg, 500mg, 1000mg.

Structural formula: {0} (CAS {1})

4-(1,3-thiazol-4-yl)phenol (CAS 68535-57-9) is a chemical compound with the molecular formula C9H7NOS and a molecular weight of 177.22 g/mol. IUPAC name: 4-(1,3-thiazol-4-yl)phenol. InChIKey: ZDXNEAWEPCZBQO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7NOS
Molecular weight177.22 g/mol
IUPAC name4-(1,3-thiazol-4-yl)phenol
InChIKeyZDXNEAWEPCZBQO-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CSC=N2)O

Computed by PubChem (NCBI)