Products 685550-63-4
CAS 685550-63-4 is the registry number for 2-((2,5-dimethoxyphenyl)amino)-2-(1,3-dioxoindan-2-ylidene)ethanenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
N-(2,5-dimethoxyphenyl)-1-hydroxy-3-oxoindene-2-carboximidoyl cyanide (CAS 685550-63-4) is a chemical compound with the molecular formula C19H14N2O4 and a molecular weight of 334.3 g/mol. IUPAC name: N-(2,5-dimethoxyphenyl)-1-hydroxy-3-oxoindene-2-carboximidoyl cyanide. InChIKey: WAXWXXMUORTCCT-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O4 |
|---|---|
| Molecular weight | 334.3 g/mol |
| IUPAC name | N-(2,5-dimethoxyphenyl)-1-hydroxy-3-oxoindene-2-carboximidoyl cyanide |
| InChIKey | WAXWXXMUORTCCT-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)N=C(C#N)C2=C(C3=CC=CC=C3C2=O)O |
Computed by PubChem (NCBI)