CAS 68575-35-9 appears in our catalog under these names: 2-(3,5-Dichlorophenyl)-2-propanol, 95-<97%, 2-(3,5-Dichlorophenyl)propan-2-ol. Offered by: Hoffman Fine Chemicals, TRC. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.
2-(3,5-dichlorophenyl)propan-2-ol (CAS 68575-35-9) is a chemical compound with the molecular formula C9H10Cl2O and a molecular weight of 205.08 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)propan-2-ol. InChIKey: LZJXTXRCENENLT-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2O |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)propan-2-ol |
| InChIKey | LZJXTXRCENENLT-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC(=C1)Cl)Cl)O |
Computed by PubChem (NCBI)