CAS 685858-98-4 is the registry number for tert-Butyl (R)-2-methyl-3-oxo-1,4-diazepane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R)-2-methyl-3-oxo-1,4-diazepane-1-carboxylate (CAS 685858-98-4) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl (2R)-2-methyl-3-oxo-1,4-diazepane-1-carboxylate. InChIKey: FDPLTIXQKBILOA-MRVPVSSYSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl (2R)-2-methyl-3-oxo-1,4-diazepane-1-carboxylate |
| InChIKey | FDPLTIXQKBILOA-MRVPVSSYSA-N |
| SMILES | C[C@@H]1C(=O)NCCCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)