Products 68742-81-4
CAS 68742-81-4 is the registry number for Ethyl L-alanyl-L-alaninate hydrochloride 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Ethyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate;hydrochloride (CAS 68742-81-4) is a chemical compound with the molecular formula C8H17ClN2O3 and a molecular weight of 224.68 g/mol. IUPAC name: ethyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate;hydrochloride. InChIKey: AMVQMJLVXQPJJV-GEMLJDPKSA-N.
| Molecular formula | C8H17ClN2O3 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | ethyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate;hydrochloride |
| InChIKey | AMVQMJLVXQPJJV-GEMLJDPKSA-N |
| SMILES | CCOC(=O)[C@H](C)NC(=O)[C@H](C)N.Cl |
Computed by PubChem (NCBI)