CAS 87244-02-8 is the registry number for D-Asparagine tert-Butyl Ester Hydrochloride. Offered by: TRC. Available pack sizes: 1g.
Tert-butyl (2R)-2,4-diamino-4-oxobutanoate;hydrochloride (CAS 87244-02-8) is a chemical compound with the molecular formula C8H17ClN2O3 and a molecular weight of 224.68 g/mol. IUPAC name: tert-butyl (2R)-2,4-diamino-4-oxobutanoate;hydrochloride. InChIKey: RXNKCUXXNGWROA-NUBCRITNSA-N.
| Molecular formula | C8H17ClN2O3 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | tert-butyl (2R)-2,4-diamino-4-oxobutanoate;hydrochloride |
| InChIKey | RXNKCUXXNGWROA-NUBCRITNSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](CC(=O)N)N.Cl |
Computed by PubChem (NCBI)