CAS 857506-76-4 is the registry number for Methyl (2r)-2-(2-aminoacetamido)-3-methylbutanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
Methyl (2R)-2-[(2-aminoacetyl)amino]-3-methylbutanoate;hydrochloride (CAS 857506-76-4) is a chemical compound with the molecular formula C8H17ClN2O3 and a molecular weight of 224.68 g/mol. IUPAC name: methyl (2R)-2-[(2-aminoacetyl)amino]-3-methylbutanoate;hydrochloride. InChIKey: SKEAZBQBMZGHEE-OGFXRTJISA-N.
| Molecular formula | C8H17ClN2O3 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | methyl (2R)-2-[(2-aminoacetyl)amino]-3-methylbutanoate;hydrochloride |
| InChIKey | SKEAZBQBMZGHEE-OGFXRTJISA-N |
| SMILES | CC(C)[C@H](C(=O)OC)NC(=O)CN.Cl |
Computed by PubChem (NCBI)