Products 687996-99-2

CAS 687996-99-2 is the registry number for Creatine-13C, 98.5%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 10 mg, 1 mg.

Structural formula: {0} (CAS {1})

2-[(C-aminocarbonimidoyl)-methylamino]acetic acid (CAS 687996-99-2) is a chemical compound with the molecular formula C4H9N3O2 and a molecular weight of 132.13 g/mol. IUPAC name: 2-[(C-aminocarbonimidoyl)-methylamino]acetic acid. InChIKey: CVSVTCORWBXHQV-AZXPZELESA-N.

Identity
Molecular formulaC4H9N3O2
Molecular weight132.13 g/mol
IUPAC name2-[(C-aminocarbonimidoyl)-methylamino]acetic acid
InChIKeyCVSVTCORWBXHQV-AZXPZELESA-N
SMILESCN(CC(=O)O)[13C](=N)N

Computed by PubChem (NCBI)