Products 68801-01-4
CAS 68801-01-4 is the registry number for 3-(4'-Carboxybenzylidene)camphor, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
4-[(E)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]benzoic acid (CAS 68801-01-4) is a chemical compound with the molecular formula C18H20O3 and a molecular weight of 284.3 g/mol. IUPAC name: 4-[(E)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]benzoic acid. InChIKey: HMSMJOAPDYWJND-JLHYYAGUSA-N.
| Molecular formula | C18H20O3 |
|---|---|
| Molecular weight | 284.3 g/mol |
| IUPAC name | 4-[(E)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]benzoic acid |
| InChIKey | HMSMJOAPDYWJND-JLHYYAGUSA-N |
| SMILES | CC1(C\2CCC1(C(=O)/C2=C/C3=CC=C(C=C3)C(=O)O)C)C |
Computed by PubChem (NCBI)