CAS 68807-89-6 is the registry number for 1-Nitroso Tryptophan. Offered by: Chemat Brand. Available pack sizes: on request.
1-nitroso-L-tryptophan is an L-tryptophan derivative in which the indolyl ring nitrogen carries a nitroso substituent.
Source: ChEBI
| Molecular formula | C11H11N3O3 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | (2S)-2-amino-3-(1-nitrosoindol-3-yl)propanoic acid |
| InChIKey | WBQJTPDOGLYTBE-VIFPVBQESA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2N=O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)