CAS 68945-00-6 is the registry number for 2-(4-Methylphenyl)-1H-indole-3-carbaldehyde. Offered by: Biosynth. Available pack sizes: 1g, 10g.
2-(4-methylphenyl)-1H-indole-3-carbaldehyde (CAS 68945-00-6) is a chemical compound with the molecular formula C16H13NO and a molecular weight of 235.28 g/mol. IUPAC name: 2-(4-methylphenyl)-1H-indole-3-carbaldehyde. InChIKey: YCCBLGKSXATWHI-UHFFFAOYSA-N.
| Molecular formula | C16H13NO |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 2-(4-methylphenyl)-1H-indole-3-carbaldehyde |
| InChIKey | YCCBLGKSXATWHI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(C3=CC=CC=C3N2)C=O |
Computed by PubChem (NCBI)