Products 69033-81-4
CAS 69033-81-4 appears in our catalog under these names: 4–Propoxycinnamic Acid, 4-Propoxycinnamic acid, 4-Propoxycinnamic acid 97% (E), 3-(4-Propoxyphenyl)acrylic acid, 97%, 3-(4-Propoxyphenyl)acrylic acid, 97% (E), 97% (E). Offered by: GLPBio, MedChemExpress, Ambeed, Combi-blocks, Fluorochem. Available pack sizes: 100g, 25g, 5g, 10 g, 1 g, 5 g, 1g.
(E)-3-(4-propoxyphenyl)prop-2-enoic acid (CAS 69033-81-4) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: (E)-3-(4-propoxyphenyl)prop-2-enoic acid. InChIKey: WTYNDSOJMSGRQV-VMPITWQZSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | (E)-3-(4-propoxyphenyl)prop-2-enoic acid |
| InChIKey | WTYNDSOJMSGRQV-VMPITWQZSA-N |
| SMILES | CCCOC1=CC=C(C=C1)/C=C/C(=O)O |
Computed by PubChem (NCBI)