CAS 690670-01-0 appears in our catalog under these names: ((2,5-Dimethoxyphenyl)carbamoyl)formic acid, 95%, ((2,5-Dimethoxyphenyl)carbamoyl)formic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(2,5-dimethoxyanilino)-2-oxoacetic acid (CAS 690670-01-0) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: 2-(2,5-dimethoxyanilino)-2-oxoacetic acid. InChIKey: VBFYLFWEVVBAOR-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | 2-(2,5-dimethoxyanilino)-2-oxoacetic acid |
| InChIKey | VBFYLFWEVVBAOR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)NC(=O)C(=O)O |
Computed by PubChem (NCBI)