CAS 69124-27-2 is the registry number for Antipyrine-4-Peroxide. Offered by: Chemat Brand. Available pack sizes: on request.
4-hydroperoxy-1,5-dimethyl-2-phenylpyrazol-3-one (CAS 69124-27-2) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 4-hydroperoxy-1,5-dimethyl-2-phenylpyrazol-3-one. InChIKey: PRHVTMZSBSBTNG-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 4-hydroperoxy-1,5-dimethyl-2-phenylpyrazol-3-one |
| InChIKey | PRHVTMZSBSBTNG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)OO |
Computed by PubChem (NCBI)