Products 691363-31-2
CAS 691363-31-2 appears in our catalog under these names: 1-Ethyl-1h-1,2,3-benzotriazole-5-carboxylic acid, 98%, 1-Ethyl-1H-benzo(d)(1,2,3)triazole-5-carboxylic acid, 98%, 1-Ethyl-1H-1,2,3-benzotriazole-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1-ethylbenzotriazole-5-carboxylic acid (CAS 691363-31-2) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 1-ethylbenzotriazole-5-carboxylic acid. InChIKey: YFLSBGGTASGZIL-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 1-ethylbenzotriazole-5-carboxylic acid |
| InChIKey | YFLSBGGTASGZIL-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)C(=O)O)N=N1 |
Computed by PubChem (NCBI)