Products 69200-18-6

CAS 69200-18-6 is the registry number for 4-Bromo-(1,1'-biphenyl)-2-carboxylic acid, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

5-bromo-2-phenylbenzoic acid (CAS 69200-18-6) is a chemical compound with the molecular formula C13H9BrO2 and a molecular weight of 277.11 g/mol. IUPAC name: 5-bromo-2-phenylbenzoic acid. InChIKey: SFZBNBYZRFOGBK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9BrO2
Molecular weight277.11 g/mol
IUPAC name5-bromo-2-phenylbenzoic acid
InChIKeySFZBNBYZRFOGBK-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=C(C=C(C=C2)Br)C(=O)O

Computed by PubChem (NCBI)