CAS 94654-52-1 appears in our catalog under these names: 3-Bromobiphenyl-2-carboxylic acid, 95%, 3–Bromobiphenyl–2–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-bromo-6-phenylbenzoic acid (CAS 94654-52-1) is a chemical compound with the molecular formula C13H9BrO2 and a molecular weight of 277.11 g/mol. IUPAC name: 2-bromo-6-phenylbenzoic acid. InChIKey: UJKBEQICHOOGBO-UHFFFAOYSA-N.
| Molecular formula | C13H9BrO2 |
|---|---|
| Molecular weight | 277.11 g/mol |
| IUPAC name | 2-bromo-6-phenylbenzoic acid |
| InChIKey | UJKBEQICHOOGBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=CC=C2)Br)C(=O)O |
Computed by PubChem (NCBI)