CAS 885951-66-6 appears in our catalog under these names: 4'-Bromobiphenyl-3-carboxylic acid, 96%, 4'-Bromo-[1,1'-biphenyl]-3-carboxylic acid 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 10g, 250mg.
3-(4-bromophenyl)benzoic acid (CAS 885951-66-6) is a chemical compound with the molecular formula C13H9BrO2 and a molecular weight of 277.11 g/mol. IUPAC name: 3-(4-bromophenyl)benzoic acid. InChIKey: IZEOXGJWZDXOEI-UHFFFAOYSA-N.
| Molecular formula | C13H9BrO2 |
|---|---|
| Molecular weight | 277.11 g/mol |
| IUPAC name | 3-(4-bromophenyl)benzoic acid |
| InChIKey | IZEOXGJWZDXOEI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)