CAS 6924-67-0 appears in our catalog under these names: 2,3-Dimethylquinoxaline-5-carboxylic acid, 97%, 2,3-Dimethylquinoxaline-5-carboxylic Acid, 2,3-Dimethyl-quinoxaline-5-carboxylic acid. Offered by: AmBeed, TRC, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,5g.
2,3-dimethylquinoxaline-5-carboxylic acid (CAS 6924-67-0) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 2,3-dimethylquinoxaline-5-carboxylic acid. InChIKey: IULOBNZHHDITLL-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 2,3-dimethylquinoxaline-5-carboxylic acid |
| InChIKey | IULOBNZHHDITLL-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC(=C2N=C1C)C(=O)O |
Computed by PubChem (NCBI)