Products 6924-67-0

CAS 6924-67-0 appears in our catalog under these names: 2,3-Dimethylquinoxaline-5-carboxylic acid, 97%, 2,3-Dimethylquinoxaline-5-carboxylic Acid, 2,3-Dimethyl-quinoxaline-5-carboxylic acid. Offered by: AmBeed, TRC, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,5g.

Structural formula: {0} (CAS {1})

2,3-dimethylquinoxaline-5-carboxylic acid (CAS 6924-67-0) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 2,3-dimethylquinoxaline-5-carboxylic acid. InChIKey: IULOBNZHHDITLL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N2O2
Molecular weight202.21 g/mol
IUPAC name2,3-dimethylquinoxaline-5-carboxylic acid
InChIKeyIULOBNZHHDITLL-UHFFFAOYSA-N
SMILESCC1=NC2=CC=CC(=C2N=C1C)C(=O)O

Computed by PubChem (NCBI)