Products 69260-38-4

CAS 69260-38-4 is the registry number for 4-(2-(Acryloyloxy)ethoxy)benzoic acid. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(2-prop-2-enoyloxyethoxy)benzoic acid (CAS 69260-38-4) is a chemical compound with the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. IUPAC name: 4-(2-prop-2-enoyloxyethoxy)benzoic acid. InChIKey: UBHQPRAAGGFDID-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12O5
Molecular weight236.22 g/mol
IUPAC name4-(2-prop-2-enoyloxyethoxy)benzoic acid
InChIKeyUBHQPRAAGGFDID-UHFFFAOYSA-N
SMILESC=CC(=O)OCCOC1=CC=C(C=C1)C(=O)O

Computed by PubChem (NCBI)