Products 69301-27-5
CAS 69301-27-5 is the registry number for Curcuphenol. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-methyl-2-[(2R)-6-methylhept-5-en-2-yl]phenol (CAS 69301-27-5) is a chemical compound with the molecular formula C15H22O and a molecular weight of 218.33 g/mol. IUPAC name: 5-methyl-2-[(2R)-6-methylhept-5-en-2-yl]phenol. InChIKey: BTXSROVNGICYFE-CYBMUJFWSA-N.
| Molecular formula | C15H22O |
|---|---|
| Molecular weight | 218.33 g/mol |
| IUPAC name | 5-methyl-2-[(2R)-6-methylhept-5-en-2-yl]phenol |
| InChIKey | BTXSROVNGICYFE-CYBMUJFWSA-N |
| SMILES | CC1=CC(=C(C=C1)[C@H](C)CCC=C(C)C)O |
Computed by PubChem (NCBI)