CAS 69306-80-5 is the registry number for 3-Phenyl-2-propenylbeta-D-glucopyranoside. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg.
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(E)-3-phenylprop-2-enoxy]oxane-3,4,5-triol (CAS 69306-80-5) is a chemical compound with the molecular formula C15H20O6 and a molecular weight of 296.31 g/mol. IUPAC name: (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(E)-3-phenylprop-2-enoxy]oxane-3,4,5-triol. InChIKey: KHPCPRHQVVSZAH-GUNCLKARSA-N.
| Molecular formula | C15H20O6 |
|---|---|
| Molecular weight | 296.31 g/mol |
| IUPAC name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(E)-3-phenylprop-2-enoxy]oxane-3,4,5-triol |
| InChIKey | KHPCPRHQVVSZAH-GUNCLKARSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/CO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)