Products 69317-48-2
CAS 69317-48-2 is the registry number for Suprofen (L-lysine). Offered by: MedChemExpress. Available pack sizes: Get quote.
[(5S)-5-amino-5-carboxypentyl]azanium;2-[4-(thiophene-2-carbonyl)phenyl]propanoate (CAS 69317-48-2) is a chemical compound with the molecular formula C20H26N2O5S and a molecular weight of 406.5 g/mol. IUPAC name: [(5S)-5-amino-5-carboxypentyl]azanium;2-[4-(thiophene-2-carbonyl)phenyl]propanoate. InChIKey: NQHVRMVONLLNME-ZSCHJXSPSA-N.
| Molecular formula | C20H26N2O5S |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | [(5S)-5-amino-5-carboxypentyl]azanium;2-[4-(thiophene-2-carbonyl)phenyl]propanoate |
| InChIKey | NQHVRMVONLLNME-ZSCHJXSPSA-N |
| SMILES | CC(C1=CC=C(C=C1)C(=O)C2=CC=CS2)C(=O)[O-].C(CC[NH3+])C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)