Products 693220-47-2
CAS 693220-47-2 is the registry number for 2-fluoro-N,3-dimethoxy-N-methylbenzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-fluoro-N,3-dimethoxy-N-methylbenzamide (CAS 693220-47-2) is a chemical compound with the molecular formula C10H12FNO3 and a molecular weight of 213.21 g/mol. IUPAC name: 2-fluoro-N,3-dimethoxy-N-methylbenzamide. InChIKey: LMAGCBWLTFAVAA-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO3 |
|---|---|
| Molecular weight | 213.21 g/mol |
| IUPAC name | 2-fluoro-N,3-dimethoxy-N-methylbenzamide |
| InChIKey | LMAGCBWLTFAVAA-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=C(C(=CC=C1)OC)F)OC |
Computed by PubChem (NCBI)