CAS 693267-71-9 is the registry number for tert-Butyl 2-amino-5,6,7,8-tetrahydro-4H-5,8-epiminocyclohepta[d]thiazole-9-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-amino-3-thia-5,11-diazatricyclo[6.2.1.02,6]undeca-2(6),4-diene-11-carboxylate (CAS 693267-71-9) is a chemical compound with the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. IUPAC name: tert-butyl 4-amino-3-thia-5,11-diazatricyclo[6.2.1.02,6]undeca-2(6),4-diene-11-carboxylate. InChIKey: CTXRAEWJHAYBNE-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O2S |
|---|---|
| Molecular weight | 281.38 g/mol |
| IUPAC name | tert-butyl 4-amino-3-thia-5,11-diazatricyclo[6.2.1.02,6]undeca-2(6),4-diene-11-carboxylate |
| InChIKey | CTXRAEWJHAYBNE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1C3=C(C2)N=C(S3)N |
Computed by PubChem (NCBI)