CAS 1346617-47-7 appears in our catalog under these names: Pramipexole Impurity 29, Propanamide, N,N'-[(6S)-4,5,6,7-tetrahydro-2,6-benzothiazolediyl]bis-, 98%, Pramipexole Impurity F, Pramipexole Impurity 9(Pramipexole Di-Amide), (S)-4,5,6,7-Tetrahydro-N2,N6-propionyl-2,6-benzothiazolediamine. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[(6S)-2-(propanoylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]propanamide (CAS 1346617-47-7) is a chemical compound with the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. IUPAC name: N-[(6S)-2-(propanoylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]propanamide. InChIKey: IENNBFXOKKQJGB-QMMMGPOBSA-N.
| Molecular formula | C13H19N3O2S |
|---|---|
| Molecular weight | 281.38 g/mol |
| IUPAC name | N-[(6S)-2-(propanoylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]propanamide |
| InChIKey | IENNBFXOKKQJGB-QMMMGPOBSA-N |
| SMILES | CCC(=O)N[C@H]1CCC2=C(C1)SC(=N2)NC(=O)CC |
Computed by PubChem (NCBI)