CAS 2682047-59-0 is the registry number for tert-Butyl 5-(2-aminothiazol-4-yl)-3,6-dihydropyridine-1(2H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 5-(2-amino-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 2682047-59-0) is a chemical compound with the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. IUPAC name: tert-butyl 5-(2-amino-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: IQABRPKXVVKYIF-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O2S |
|---|---|
| Molecular weight | 281.38 g/mol |
| IUPAC name | tert-butyl 5-(2-amino-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| InChIKey | IQABRPKXVVKYIF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC=C(C1)C2=CSC(=N2)N |
Computed by PubChem (NCBI)