CAS 88919-50-0 is the registry number for Sumatriptan Impurity 17. Offered by: Chemat Brand. Available pack sizes: on request.
[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]methanesulfonamide (CAS 88919-50-0) is a chemical compound with the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. IUPAC name: [3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]methanesulfonamide. InChIKey: IZEQRYXPOFFPCG-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O2S |
|---|---|
| Molecular weight | 281.38 g/mol |
| IUPAC name | [3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]methanesulfonamide |
| InChIKey | IZEQRYXPOFFPCG-UHFFFAOYSA-N |
| SMILES | CN(C)CCC1=CNC2=C1C=C(C=C2)CS(=O)(=O)N |
Computed by PubChem (NCBI)