CAS 6934-03-8 appears in our catalog under these names: 3-tert-Butyl-2-hydroxy-6-methylbenzoic acid, 95%, 3-(tert-Butyl)-2-hydroxy-6-methylbenzoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 5g, 1g, 250mg.
3-tert-butyl-2-hydroxy-6-methylbenzoic acid (CAS 6934-03-8) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 3-tert-butyl-2-hydroxy-6-methylbenzoic acid. InChIKey: JXQCUCDXLSGQNZ-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 3-tert-butyl-2-hydroxy-6-methylbenzoic acid |
| InChIKey | JXQCUCDXLSGQNZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(C)(C)C)O)C(=O)O |
Computed by PubChem (NCBI)